C22H23F3O3 — CID 155811953
(3E,3aS,9R,9bS)-9-hydroxy-6,9-dimethyl-3-[[3-(trifluoromethyl)phenyl]methylidene]-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one (PubChem CID 155811953) has the molecular formula C22H23F3O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is (3E,3aS,9R,9bS)-9-hydroxy-6,9-dimethyl-3-[[3-(trifluoromethyl)phenyl]methylidene]-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one.
| Compound Name | (3E,3aS,9R,9bS)-9-hydroxy-6,9-dimethyl-3-[[3-(trifluoromethyl)phenyl]methylidene]-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 155811953 |
| Molecular Formula | C22H23F3O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (3E,3aS,9R,9bS)-9-hydroxy-6,9-dimethyl-3-[[3-(trifluoromethyl)phenyl]methylidene]-4,5,7,8,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one |
| SMILES | CC1=C2CC[C@@](C)(O)C2[C@H]2OC(=O)/C(=C/c3cccc(C(F)(F)F)c3)[C@@H]2CC1 |
| InChI | InChI=1S/C22H23F3O3/c1-12-6-7-16-17(11-13-4-3-5-14(10-13)22(23,24)25)20(26)28-19(16)18-15(12)8-9-21(18,2)27/h3-5,10-11,16,18-19,27H,6-9H2,1-2H3/b17-11+/t16-,18?,19-,21+/m0/s1 |
| InChIKey | SCENBDNYFVDEMA-CUOVBLCVSA-N |
| XLogP | 4.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|