C5H5N5OS — CID 155811958
(2Z)-2-(1H-1,2,4-triazol-5-ylimino)-1,3-thiazolidin-4-one (PubChem CID 155811958) has the molecular formula C5H5N5OS and a molecular weight of 183.20 g/mol. Its IUPAC name is (2Z)-2-(1H-1,2,4-triazol-5-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-2-(1H-1,2,4-triazol-5-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 155811958 |
| Molecular Formula | C5H5N5OS |
| Molecular Weight | 183.20 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | (2Z)-2-(1H-1,2,4-triazol-5-ylimino)-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\c2ncn[nH]2)N1 |
| InChI | InChI=1S/C5H5N5OS/c11-3-1-12-5(8-3)9-4-6-2-7-10-4/h2H,1H2,(H2,6,7,8,9,10,11) |
| InChIKey | ZDCQSRVDRUBMGJ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.20 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|