C17H23N4O6P — CID 15581206
1-[[(2S)-2-[(1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carbonyl)amino]propanoyl]amino]ethylphosphonic acid (PubChem CID 15581206) has the molecular formula C17H23N4O6P and a molecular weight of 410.37 g/mol. Its IUPAC name is 1-[[(2S)-2-[(1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carbonyl)amino]propanoyl]amino]ethylphosphonic acid.
| Compound Name | 1-[[(2S)-2-[(1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carbonyl)amino]propanoyl]amino]ethylphosphonic acid |
|---|---|
| PubChem CID | 15581206 |
| Molecular Formula | C17H23N4O6P |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 1-[[(2S)-2-[(1-ethyl-7-methyl-4-oxo-1,8-naphthyridine-3-carbonyl)amino]propanoyl]amino]ethylphosphonic acid |
| SMILES | CCn1cc(C(=O)N[C@@H](C)C(=O)NC(C)P(=O)(O)O)c(=O)c2ccc(C)nc21 |
| InChI | InChI=1S/C17H23N4O6P/c1-5-21-8-13(14(22)12-7-6-9(2)18-15(12)21)17(24)19-10(3)16(23)20-11(4)28(25,26)27/h6-8,10-11H,5H2,1-4H3,(H,19,24)(H,20,23)(H2,25,26,27)/t10-,11?/m0/s1 |
| InChIKey | SUCWFTPCPCRUIQ-VUWPPUDQSA-N |
| XLogP | 0.48 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|