About 4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine
4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine (PubChem CID 155812068) has the molecular formula C22H16N4S
and a molecular weight of 368.47 g/mol. Its IUPAC name is 4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine.
Molecular Properties
| Compound Name | 4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine |
| PubChem CID | 155812068 |
| Molecular Formula | C22H16N4S |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine |
| SMILES | Nc1ccc2[nH]cc(-c3c4ccsc4cc4[nH]c5ccc(N)cc5c34)c2c1 |
| InChI | InChI=1S/C22H16N4S/c23-11-1-3-17-14(7-11)16(10-25-17)21-13-5-6-27-20(13)9-19-22(21)15-8-12(24)2-4-18(15)26-19/h1-10,25-26H,23-24H2 |
| InChIKey | LWOVRYNVJDTVTH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 83.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine?
The IUPAC name of 4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine (CID 155812068) is 4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine.
What is the SMILES notation for 4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine?
The canonical SMILES for 4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine is Nc1ccc2[nH]cc(-c3c4ccsc4cc4[nH]c5ccc(N)cc5c34)c2c1.
What is the InChIKey of 4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine?
The InChIKey is LWOVRYNVJDTVTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N4S/c23-11-1-3-17-14(7-11)16(10-25-17)21-13-5-6-27-20(13)9-19-22(21)15-8-12(24)2-4-18(15)26-19/h1-10,25-26H,23-24H2.
What are the key properties of 4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine?
4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine has a molecular weight of 368.47 g/mol, XLogP of 5.85, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-amino-1H-indol-3-yl)-9H-thieno[2,3-b]carbazol-6-amine is sourced from PubChem (CID 155812068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).