C28H31N5S — CID 155812157
4-(1-methylpyrrolo[2,3-b]pyridin-3-yl)-2-[1-(4-piperidin-1-ylbutyl)indol-3-yl]-1,3-thiazole (PubChem CID 155812157) has the molecular formula C28H31N5S and a molecular weight of 469.66 g/mol. Its IUPAC name is 4-(1-methylpyrrolo[2,3-b]pyridin-3-yl)-2-[1-(4-piperidin-1-ylbutyl)indol-3-yl]-1,3-thiazole.
| Compound Name | 4-(1-methylpyrrolo[2,3-b]pyridin-3-yl)-2-[1-(4-piperidin-1-ylbutyl)indol-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 155812157 |
| Molecular Formula | C28H31N5S |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 4-(1-methylpyrrolo[2,3-b]pyridin-3-yl)-2-[1-(4-piperidin-1-ylbutyl)indol-3-yl]-1,3-thiazole |
| SMILES | Cn1cc(-c2csc(-c3cn(CCCCN4CCCCC4)c4ccccc34)n2)c2cccnc21 |
| InChI | InChI=1S/C28H31N5S/c1-31-18-23(22-11-9-13-29-27(22)31)25-20-34-28(30-25)24-19-33(26-12-4-3-10-21(24)26)17-8-7-16-32-14-5-2-6-15-32/h3-4,9-13,18-20H,2,5-8,14-17H2,1H3 |
| InChIKey | OFGRJLNDUXMWSS-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|