C29H22Cl2N6O — CID 155812273
5'-chloro-8-(4-chlorophenyl)-1',6-dimethyl-4-phenylspiro[2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-12,3'-indole]-2'-one (PubChem CID 155812273) has the molecular formula C29H22Cl2N6O and a molecular weight of 541.44 g/mol. Its IUPAC name is 5'-chloro-8-(4-chlorophenyl)-1',6-dimethyl-4-phenylspiro[2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-12,3'-indole]-2'-one.
| Compound Name | 5'-chloro-8-(4-chlorophenyl)-1',6-dimethyl-4-phenylspiro[2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-12,3'-indole]-2'-one |
|---|---|
| PubChem CID | 155812273 |
| Molecular Formula | C29H22Cl2N6O |
| Molecular Weight | 541.44 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | 5'-chloro-8-(4-chlorophenyl)-1',6-dimethyl-4-phenylspiro[2,4,5,11,13-pentazatricyclo[7.4.0.03,7]trideca-1,3(7),5,8-tetraene-12,3'-indole]-2'-one |
| SMILES | Cc1nn(-c2ccccc2)c2nc3c(c(-c4ccc(Cl)cc4)c12)CNC1(N3)C(=O)N(C)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C29H22Cl2N6O/c1-16-24-25(17-8-10-18(30)11-9-17)21-15-32-29(22-14-19(31)12-13-23(22)36(2)28(29)38)34-26(21)33-27(24)37(35-16)20-6-4-3-5-7-20/h3-14,32H,15H2,1-2H3,(H,33,34) |
| InChIKey | QVUPOCUAWIFYTF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.44 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |