C19H14ClN5OS2 — CID 155812328
1-(4-chlorophenyl)-3-[7-(4-methylphenyl)-4-oxo-5H-[1,3]thiazolo[4,5-d]pyridazin-2-yl]thiourea (PubChem CID 155812328) has the molecular formula C19H14ClN5OS2 and a molecular weight of 427.94 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[7-(4-methylphenyl)-4-oxo-5H-[1,3]thiazolo[4,5-d]pyridazin-2-yl]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[7-(4-methylphenyl)-4-oxo-5H-[1,3]thiazolo[4,5-d]pyridazin-2-yl]thiourea |
|---|---|
| PubChem CID | 155812328 |
| Molecular Formula | C19H14ClN5OS2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[7-(4-methylphenyl)-4-oxo-5H-[1,3]thiazolo[4,5-d]pyridazin-2-yl]thiourea |
| SMILES | Cc1ccc(-c2n[nH]c(=O)c3nc(NC(=S)Nc4ccc(Cl)cc4)sc23)cc1 |
| InChI | InChI=1S/C19H14ClN5OS2/c1-10-2-4-11(5-3-10)14-16-15(17(26)25-24-14)22-19(28-16)23-18(27)21-13-8-6-12(20)7-9-13/h2-9H,1H3,(H,25,26)(H2,21,22,23,27) |
| InChIKey | DHFGHGDBYZBGSG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|