C24H19N3O4 — CID 155813439
11-(3,4,5-trimethoxyphenyl)-5H-pyrido[3,2-c][1,7]phenanthrolin-6-one (PubChem CID 155813439) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is 11-(3,4,5-trimethoxyphenyl)-5H-pyrido[3,2-c][1,7]phenanthrolin-6-one.
| Compound Name | 11-(3,4,5-trimethoxyphenyl)-5H-pyrido[3,2-c][1,7]phenanthrolin-6-one |
|---|---|
| PubChem CID | 155813439 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 11-(3,4,5-trimethoxyphenyl)-5H-pyrido[3,2-c][1,7]phenanthrolin-6-one |
| SMILES | COc1cc(-c2cc3ncccc3c3[nH]c(=O)c4cccnc4c23)cc(OC)c1OC |
| InChI | InChI=1S/C24H19N3O4/c1-29-18-10-13(11-19(30-2)23(18)31-3)16-12-17-14(6-4-8-25-17)22-20(16)21-15(24(28)27-22)7-5-9-26-21/h4-12H,1-3H3,(H,27,28) |
| InChIKey | WMVSZKJHXSEMPJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|