C23H22FNO3 — CID 155813672
benzyl 1-(4-fluorophenyl)-2-methyl-3-oxo-4,5,6,7-tetrahydroindole-2-carboxylate (PubChem CID 155813672) has the molecular formula C23H22FNO3 and a molecular weight of 379.43 g/mol. Its IUPAC name is benzyl 1-(4-fluorophenyl)-2-methyl-3-oxo-4,5,6,7-tetrahydroindole-2-carboxylate.
| Compound Name | benzyl 1-(4-fluorophenyl)-2-methyl-3-oxo-4,5,6,7-tetrahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 155813672 |
| Molecular Formula | C23H22FNO3 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | benzyl 1-(4-fluorophenyl)-2-methyl-3-oxo-4,5,6,7-tetrahydroindole-2-carboxylate |
| SMILES | CC1(C(=O)OCc2ccccc2)C(=O)C2=C(CCCC2)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H22FNO3/c1-23(22(27)28-15-16-7-3-2-4-8-16)21(26)19-9-5-6-10-20(19)25(23)18-13-11-17(24)12-14-18/h2-4,7-8,11-14H,5-6,9-10,15H2,1H3 |
| InChIKey | WUKMMQAFVMLJPJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|