C20H12N4O2 — CID 155814510
13-methyl-15-phenyl-11,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16),13-heptaene-8,9-dione (PubChem CID 155814510) has the molecular formula C20H12N4O2 and a molecular weight of 340.34 g/mol. Its IUPAC name is 13-methyl-15-phenyl-11,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16),13-heptaene-8,9-dione.
| Compound Name | 13-methyl-15-phenyl-11,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16),13-heptaene-8,9-dione |
|---|---|
| PubChem CID | 155814510 |
| Molecular Formula | C20H12N4O2 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 13-methyl-15-phenyl-11,14,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,10,12(16),13-heptaene-8,9-dione |
| SMILES | Cc1nn(-c2ccccc2)c2nc3c(nc12)C(=O)C(=O)c1ccccc1-3 |
| InChI | InChI=1S/C20H12N4O2/c1-11-15-20(24(23-11)12-7-3-2-4-8-12)22-16-13-9-5-6-10-14(13)18(25)19(26)17(16)21-15/h2-10H,1H3 |
| InChIKey | PWRTZDGZLAAVCL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|