C30H19F2NO2 — CID 155814563
(E)-3-(3,4-difluorophenyl)-N-[4-[(10-oxoanthracen-9-ylidene)methyl]phenyl]prop-2-enamide (PubChem CID 155814563) has the molecular formula C30H19F2NO2 and a molecular weight of 463.48 g/mol. Its IUPAC name is (E)-3-(3,4-difluorophenyl)-N-[4-[(10-oxoanthracen-9-ylidene)methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-difluorophenyl)-N-[4-[(10-oxoanthracen-9-ylidene)methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155814563 |
| Molecular Formula | C30H19F2NO2 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | (E)-3-(3,4-difluorophenyl)-N-[4-[(10-oxoanthracen-9-ylidene)methyl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)c(F)c1)Nc1ccc(C=C2c3ccccc3C(=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C30H19F2NO2/c31-27-15-11-20(18-28(27)32)12-16-29(34)33-21-13-9-19(10-14-21)17-26-22-5-1-3-7-24(22)30(35)25-8-4-2-6-23(25)26/h1-18H,(H,33,34)/b16-12+ |
| InChIKey | FNOVUMHKHVWLHZ-FOWTUZBSSA-N |
| XLogP | 6.75 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_quin_methide(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|