C23H37NO2 — CID 155814643
[1-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]piperidin-4-yl]methanol (PubChem CID 155814643) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is [1-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]piperidin-4-yl]methanol.
| Compound Name | [1-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 155814643 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | [1-[(4E,8E)-11-(furan-3-yl)-4,8-dimethylundeca-4,8-dienyl]piperidin-4-yl]methanol |
| SMILES | C/C(=C\CCc1ccoc1)CC/C=C(\C)CCCN1CCC(CO)CC1 |
| InChI | InChI=1S/C23H37NO2/c1-20(8-4-10-23-13-17-26-19-23)6-3-7-21(2)9-5-14-24-15-11-22(18-25)12-16-24/h7-8,13,17,19,22,25H,3-6,9-12,14-16,18H2,1-2H3/b20-8+,21-7+ |
| InChIKey | JKGUXGSWVLFJNV-LHEDLMNPSA-N |
| XLogP | 5.37 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|