C25H34N6O4 — CID 155814814
2-[4-[2-(1,3-dimethyl-2,4-dioxo-7,9-dihydro-6H-purino[7,8-a]pyrazin-8-yl)ethyl]phenoxy]-N-pentylacetamide (PubChem CID 155814814) has the molecular formula C25H34N6O4 and a molecular weight of 482.59 g/mol. Its IUPAC name is 2-[4-[2-(1,3-dimethyl-2,4-dioxo-7,9-dihydro-6H-purino[7,8-a]pyrazin-8-yl)ethyl]phenoxy]-N-pentylacetamide.
| Compound Name | 2-[4-[2-(1,3-dimethyl-2,4-dioxo-7,9-dihydro-6H-purino[7,8-a]pyrazin-8-yl)ethyl]phenoxy]-N-pentylacetamide |
|---|---|
| PubChem CID | 155814814 |
| Molecular Formula | C25H34N6O4 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 2-[4-[2-(1,3-dimethyl-2,4-dioxo-7,9-dihydro-6H-purino[7,8-a]pyrazin-8-yl)ethyl]phenoxy]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)COc1ccc(CCN2CCn3c(nc4c3c(=O)n(C)c(=O)n4C)C2)cc1 |
| InChI | InChI=1S/C25H34N6O4/c1-4-5-6-12-26-21(32)17-35-19-9-7-18(8-10-19)11-13-30-14-15-31-20(16-30)27-23-22(31)24(33)29(3)25(34)28(23)2/h7-10H,4-6,11-17H2,1-3H3,(H,26,32) |
| InChIKey | HLOSWCFEEBURBT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 103.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|