C22H28O3 — CID 155814830
(1E,4S,9Z,12R)-4-[(2Z,5Z)-octa-2,5-dienyl]-5-oxabicyclo[10.3.0]pentadeca-1,9,13-triene-6,15-dione (PubChem CID 155814830) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (1E,4S,9Z,12R)-4-[(2Z,5Z)-octa-2,5-dienyl]-5-oxabicyclo[10.3.0]pentadeca-1,9,13-triene-6,15-dione.
| Compound Name | (1E,4S,9Z,12R)-4-[(2Z,5Z)-octa-2,5-dienyl]-5-oxabicyclo[10.3.0]pentadeca-1,9,13-triene-6,15-dione |
|---|---|
| PubChem CID | 155814830 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (1E,4S,9Z,12R)-4-[(2Z,5Z)-octa-2,5-dienyl]-5-oxabicyclo[10.3.0]pentadeca-1,9,13-triene-6,15-dione |
| SMILES | CC/C=C\C/C=C\C[C@H]1C/C=C2/C(=O)C=C[C@H]2C/C=C\CCC(=O)O1 |
| InChI | InChI=1S/C22H28O3/c1-2-3-4-5-6-9-12-19-15-16-20-18(14-17-21(20)23)11-8-7-10-13-22(24)25-19/h3-4,6-9,14,16-19H,2,5,10-13,15H2,1H3/b4-3-,8-7-,9-6-,20-16+/t18-,19+/m1/s1 |
| InChIKey | IBNQWLQHKGCPPD-JNQZYWRGSA-N |
| XLogP | 5.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|