C27H30FN3O5 — CID 155814861
3-O-[2-(dimethylamino)ethylamino] 2-O-methyl 1-[1-(4-fluoroanilino)-2-phenylethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 155814861) has the molecular formula C27H30FN3O5 and a molecular weight of 495.55 g/mol. Its IUPAC name is 3-O-[2-(dimethylamino)ethylamino] 2-O-methyl 1-[1-(4-fluoroanilino)-2-phenylethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | 3-O-[2-(dimethylamino)ethylamino] 2-O-methyl 1-[1-(4-fluoroanilino)-2-phenylethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 155814861 |
| Molecular Formula | C27H30FN3O5 |
| Molecular Weight | 495.55 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 3-O-[2-(dimethylamino)ethylamino] 2-O-methyl 1-[1-(4-fluoroanilino)-2-phenylethyl]-7-oxabicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)ONCCN(C)C)C2C=CC1(C(Cc1ccccc1)Nc1ccc(F)cc1)O2 |
| InChI | InChI=1S/C27H30FN3O5/c1-31(2)16-15-29-36-25(32)23-21-13-14-27(35-21,24(23)26(33)34-3)22(17-18-7-5-4-6-8-18)30-20-11-9-19(28)10-12-20/h4-14,21-22,29-30H,15-17H2,1-3H3 |
| InChIKey | JXIAEZNXJFOUMO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|