C22H21NO4 — CID 155814912
8-ethyl-2-(4-methoxyphenyl)-5,9-dimethyl-3H-pyrano[3,2-g][1,4]benzoxazin-7-one (PubChem CID 155814912) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is 8-ethyl-2-(4-methoxyphenyl)-5,9-dimethyl-3H-pyrano[3,2-g][1,4]benzoxazin-7-one.
| Compound Name | 8-ethyl-2-(4-methoxyphenyl)-5,9-dimethyl-3H-pyrano[3,2-g][1,4]benzoxazin-7-one |
|---|---|
| PubChem CID | 155814912 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 8-ethyl-2-(4-methoxyphenyl)-5,9-dimethyl-3H-pyrano[3,2-g][1,4]benzoxazin-7-one |
| SMILES | CCc1c(C)c2cc3c(c(C)c2oc1=O)OCC(c1ccc(OC)cc1)=N3 |
| InChI | InChI=1S/C22H21NO4/c1-5-16-12(2)17-10-18-21(13(3)20(17)27-22(16)24)26-11-19(23-18)14-6-8-15(25-4)9-7-14/h6-10H,5,11H2,1-4H3 |
| InChIKey | RJLIZZVYLGQASW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 61.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|