About ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate
ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate (PubChem CID 155815144) has the molecular formula C13H15ClN2O2S
and a molecular weight of 298.80 g/mol. Its IUPAC name is ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate |
| PubChem CID | 155815144 |
| Molecular Formula | C13H15ClN2O2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)CC1CSC(Nc2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C13H15ClN2O2S/c1-2-18-12(17)7-11-8-19-13(16-11)15-10-5-3-9(14)4-6-10/h3-6,11H,2,7-8H2,1H3,(H,15,16) |
| InChIKey | NVBUWYBHVQAIDG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate?
The IUPAC name of ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate (CID 155815144) is ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate.
What is the SMILES notation for ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate?
The canonical SMILES for ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate is CCOC(=O)CC1CSC(Nc2ccc(Cl)cc2)=N1.
What is the InChIKey of ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate?
The InChIKey is NVBUWYBHVQAIDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClN2O2S/c1-2-18-12(17)7-11-8-19-13(16-11)15-10-5-3-9(14)4-6-10/h3-6,11H,2,7-8H2,1H3,(H,15,16).
What are the key properties of ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate?
ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate has a molecular weight of 298.80 g/mol, XLogP of 3.18, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-(4-chloroanilino)-4,5-dihydro-1,3-thiazol-4-yl]acetate is sourced from PubChem (CID 155815144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).