C21H19N3S — CID 155815282
(2R)-2-methyl-3,5-diphenyl-10-thia-3,4,6-triazatricyclo[7.3.0.02,6]dodeca-1(9),4,11-triene (PubChem CID 155815282) has the molecular formula C21H19N3S and a molecular weight of 345.47 g/mol. Its IUPAC name is (2R)-2-methyl-3,5-diphenyl-10-thia-3,4,6-triazatricyclo[7.3.0.02,6]dodeca-1(9),4,11-triene.
| Compound Name | (2R)-2-methyl-3,5-diphenyl-10-thia-3,4,6-triazatricyclo[7.3.0.02,6]dodeca-1(9),4,11-triene |
|---|---|
| PubChem CID | 155815282 |
| Molecular Formula | C21H19N3S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | (2R)-2-methyl-3,5-diphenyl-10-thia-3,4,6-triazatricyclo[7.3.0.02,6]dodeca-1(9),4,11-triene |
| SMILES | C[C@@]12c3ccsc3CCN1C(c1ccccc1)=NN2c1ccccc1 |
| InChI | InChI=1S/C21H19N3S/c1-21-18-13-15-25-19(18)12-14-23(21)20(16-8-4-2-5-9-16)22-24(21)17-10-6-3-7-11-17/h2-11,13,15H,12,14H2,1H3/t21-/m1/s1 |
| InChIKey | ZWFIHHPEMHFTPD-OAQYLSRUSA-N |
| XLogP | 4.66 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |