C15H12N4OS2 — CID 155815329
(2E,5Z)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-[(E)-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one (PubChem CID 155815329) has the molecular formula C15H12N4OS2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (2E,5Z)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-[(E)-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-[(E)-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 155815329 |
| Molecular Formula | C15H12N4OS2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | (2E,5Z)-2-[(5-methyl-1,3,4-thiadiazol-2-yl)imino]-5-[(E)-3-phenylprop-2-enylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1nnc(/N=C2\NC(=O)/C(=C/C=C/c3ccccc3)S2)s1 |
| InChI | InChI=1S/C15H12N4OS2/c1-10-18-19-15(21-10)17-14-16-13(20)12(22-14)9-5-8-11-6-3-2-4-7-11/h2-9H,1H3,(H,16,17,19,20)/b8-5+,12-9- |
| InChIKey | QXOFUBBGDWTZJX-VQDMZCOGSA-N |
| XLogP | 3.29 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|