C21H30O4 — CID 155815414
methyl (Z)-7-[(1R,5E)-5-[(Z,3R)-3-hydroxyoct-5-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate (PubChem CID 155815414) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,5E)-5-[(Z,3R)-3-hydroxyoct-5-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,5E)-5-[(Z,3R)-3-hydroxyoct-5-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 155815414 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | methyl (Z)-7-[(1R,5E)-5-[(Z,3R)-3-hydroxyoct-5-enylidene]-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
| SMILES | CC/C=C\C[C@@H](O)C/C=C1/C(=O)C=C[C@H]1C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C21H30O4/c1-3-4-7-11-18(22)14-15-19-17(13-16-20(19)23)10-8-5-6-9-12-21(24)25-2/h4-5,7-8,13,15-18,22H,3,6,9-12,14H2,1-2H3/b7-4-,8-5-,19-15+/t17-,18-/m1/s1 |
| InChIKey | QCNUNYMTCGCHDR-JWFJKBGYSA-N |
| XLogP | 4.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|