C18H14N4OS — CID 155815682
2-pyrido[3,4-b]indol-9-yl-N-[(E)-thiophen-2-ylmethylideneamino]acetamide (PubChem CID 155815682) has the molecular formula C18H14N4OS and a molecular weight of 334.40 g/mol. Its IUPAC name is 2-pyrido[3,4-b]indol-9-yl-N-[(E)-thiophen-2-ylmethylideneamino]acetamide.
| Compound Name | 2-pyrido[3,4-b]indol-9-yl-N-[(E)-thiophen-2-ylmethylideneamino]acetamide |
|---|---|
| PubChem CID | 155815682 |
| Molecular Formula | C18H14N4OS |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 2-pyrido[3,4-b]indol-9-yl-N-[(E)-thiophen-2-ylmethylideneamino]acetamide |
| SMILES | O=C(Cn1c2ccccc2c2ccncc21)N/N=C/c1cccs1 |
| InChI | InChI=1S/C18H14N4OS/c23-18(21-20-10-13-4-3-9-24-13)12-22-16-6-2-1-5-14(16)15-7-8-19-11-17(15)22/h1-11H,12H2,(H,21,23)/b20-10+ |
| InChIKey | PDOXFTAVNBMLJO-KEBDBYFISA-N |
| XLogP | 3.40 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|