C10H17N5OS — CID 155815776
4,6-dimethyl-2-morpholin-4-yl-3a,6a-dihydro-1H-imidazo[4,5-d]imidazole-5-thione (PubChem CID 155815776) has the molecular formula C10H17N5OS and a molecular weight of 255.35 g/mol. Its IUPAC name is 4,6-dimethyl-2-morpholin-4-yl-3a,6a-dihydro-1H-imidazo[4,5-d]imidazole-5-thione.
| Compound Name | 4,6-dimethyl-2-morpholin-4-yl-3a,6a-dihydro-1H-imidazo[4,5-d]imidazole-5-thione |
|---|---|
| PubChem CID | 155815776 |
| Molecular Formula | C10H17N5OS |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 4,6-dimethyl-2-morpholin-4-yl-3a,6a-dihydro-1H-imidazo[4,5-d]imidazole-5-thione |
| SMILES | CN1C(=S)N(C)C2NC(N3CCOCC3)=NC21 |
| InChI | InChI=1S/C10H17N5OS/c1-13-7-8(14(2)10(13)17)12-9(11-7)15-3-5-16-6-4-15/h7-8H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | PCKNRUSENZWHLK-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|