C11H8Cl2N2O2 — CID 155815830
7,8-dichloro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole-6,9-dione (PubChem CID 155815830) has the molecular formula C11H8Cl2N2O2 and a molecular weight of 271.10 g/mol. Its IUPAC name is 7,8-dichloro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole-6,9-dione.
| Compound Name | 7,8-dichloro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole-6,9-dione |
|---|---|
| PubChem CID | 155815830 |
| Molecular Formula | C11H8Cl2N2O2 |
| Molecular Weight | 271.10 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 7,8-dichloro-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazole-6,9-dione |
| SMILES | O=C1C(Cl)=C(Cl)C(=O)c2c1nc1n2CCCC1 |
| InChI | InChI=1S/C11H8Cl2N2O2/c12-6-7(13)11(17)9-8(10(6)16)14-5-3-1-2-4-15(5)9/h1-4H2 |
| InChIKey | WILNZFAEFLHSQS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.10 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|