C20H14N4OS — CID 155816046
(3E)-3-[(2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylidene]-1H-indol-2-one (PubChem CID 155816046) has the molecular formula C20H14N4OS and a molecular weight of 358.43 g/mol. Its IUPAC name is (3E)-3-[(2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylidene]-1H-indol-2-one.
| Compound Name | (3E)-3-[(2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 155816046 |
| Molecular Formula | C20H14N4OS |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | (3E)-3-[(2-methyl-6-phenylimidazo[2,1-b][1,3,4]thiadiazol-5-yl)methylidene]-1H-indol-2-one |
| SMILES | Cc1nn2c(/C=C3/C(=O)Nc4ccccc43)c(-c3ccccc3)nc2s1 |
| InChI | InChI=1S/C20H14N4OS/c1-12-23-24-17(11-15-14-9-5-6-10-16(14)21-19(15)25)18(22-20(24)26-12)13-7-3-2-4-8-13/h2-11H,1H3,(H,21,25)/b15-11+ |
| InChIKey | NLIITVWPMBINPD-RVDMUPIBSA-N |
| XLogP | 4.26 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|