C16H18O2S — CID 155816098
(6R)-3,4,6'-trimethyl-1-oxospiro[2,5-dihydrothiopyran-6,2'-3H-indene]-1'-one (PubChem CID 155816098) has the molecular formula C16H18O2S and a molecular weight of 274.38 g/mol. Its IUPAC name is (6R)-3,4,6'-trimethyl-1-oxospiro[2,5-dihydrothiopyran-6,2'-3H-indene]-1'-one.
| Compound Name | (6R)-3,4,6'-trimethyl-1-oxospiro[2,5-dihydrothiopyran-6,2'-3H-indene]-1'-one |
|---|---|
| PubChem CID | 155816098 |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (6R)-3,4,6'-trimethyl-1-oxospiro[2,5-dihydrothiopyran-6,2'-3H-indene]-1'-one |
| SMILES | CC1=C(C)C[C@]2(Cc3ccc(C)cc3C2=O)S(=O)C1 |
| InChI | InChI=1S/C16H18O2S/c1-10-4-5-13-8-16(15(17)14(13)6-10)7-11(2)12(3)9-19(16)18/h4-6H,7-9H2,1-3H3/t16-,19?/m1/s1 |
| InChIKey | FRXLBRMDJCRUJX-VTBWFHPJSA-N |
| XLogP | 2.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|