C27H21FN6O2S2 — CID 155816162
N-[2-[[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]naphthalene-2-sulfonamide (PubChem CID 155816162) has the molecular formula C27H21FN6O2S2 and a molecular weight of 544.64 g/mol. Its IUPAC name is N-[2-[[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]naphthalene-2-sulfonamide.
| Compound Name | N-[2-[[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 155816162 |
| Molecular Formula | C27H21FN6O2S2 |
| Molecular Weight | 544.64 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | N-[2-[[4-[6-(4-fluorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]pyrimidin-2-yl]amino]ethyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCCNc1nccc(-c2c(-c3ccc(F)cc3)nc3sccn23)n1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H21FN6O2S2/c28-21-8-5-19(6-9-21)24-25(34-15-16-37-27(34)33-24)23-11-12-29-26(32-23)30-13-14-31-38(35,36)22-10-7-18-3-1-2-4-20(18)17-22/h1-12,15-17,31H,13-14H2,(H,29,30,32) |
| InChIKey | BZFNZDLNZZMLDQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.64 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|