C15H14N6O3S — CID 155816329
2-[4-(2-methyl-4-oxopyrido[2,3-d]pyrimidin-3-yl)phenyl]sulfonylguanidine (PubChem CID 155816329) has the molecular formula C15H14N6O3S and a molecular weight of 358.38 g/mol. Its IUPAC name is 2-[4-(2-methyl-4-oxopyrido[2,3-d]pyrimidin-3-yl)phenyl]sulfonylguanidine.
| Compound Name | 2-[4-(2-methyl-4-oxopyrido[2,3-d]pyrimidin-3-yl)phenyl]sulfonylguanidine |
|---|---|
| PubChem CID | 155816329 |
| Molecular Formula | C15H14N6O3S |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 2-[4-(2-methyl-4-oxopyrido[2,3-d]pyrimidin-3-yl)phenyl]sulfonylguanidine |
| SMILES | Cc1nc2ncccc2c(=O)n1-c1ccc(S(=O)(=O)N=C(N)N)cc1 |
| InChI | InChI=1S/C15H14N6O3S/c1-9-19-13-12(3-2-8-18-13)14(22)21(9)10-4-6-11(7-5-10)25(23,24)20-15(16)17/h2-8H,1H3,(H4,16,17,20) |
| InChIKey | SLXJDHPXMAOPIB-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 146.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|