C26H28N8O5 — CID 155816422
5-[[1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)indol-3-yl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 155816422) has the molecular formula C26H28N8O5 and a molecular weight of 532.56 g/mol. Its IUPAC name is 5-[[1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)indol-3-yl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)indol-3-yl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 155816422 |
| Molecular Formula | C26H28N8O5 |
| Molecular Weight | 532.56 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 5-[[1-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)indol-3-yl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(=Cc2cn(-c3nc(N4CCOCC4)nc(N4CCOCC4)n3)c3ccccc23)C(=O)N(C)C1=O |
| InChI | InChI=1S/C26H28N8O5/c1-30-21(35)19(22(36)31(2)26(30)37)15-17-16-34(20-6-4-3-5-18(17)20)25-28-23(32-7-11-38-12-8-32)27-24(29-25)33-9-13-39-14-10-33/h3-6,15-16H,7-14H2,1-2H3 |
| InChIKey | PSADYPNJCSUUQT-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 126.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.56 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|