C27H28FN5OS — CID 155816553
4-[4-[5-fluoro-3-[4-(1-methylpyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-yl]indol-1-yl]butyl]morpholine (PubChem CID 155816553) has the molecular formula C27H28FN5OS and a molecular weight of 489.62 g/mol. Its IUPAC name is 4-[4-[5-fluoro-3-[4-(1-methylpyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-yl]indol-1-yl]butyl]morpholine.
| Compound Name | 4-[4-[5-fluoro-3-[4-(1-methylpyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-yl]indol-1-yl]butyl]morpholine |
|---|---|
| PubChem CID | 155816553 |
| Molecular Formula | C27H28FN5OS |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 4-[4-[5-fluoro-3-[4-(1-methylpyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazol-2-yl]indol-1-yl]butyl]morpholine |
| SMILES | Cn1cc(-c2csc(-c3cn(CCCCN4CCOCC4)c4ccc(F)cc34)n2)c2cccnc21 |
| InChI | InChI=1S/C27H28FN5OS/c1-31-16-22(20-5-4-8-29-26(20)31)24-18-35-27(30-24)23-17-33(25-7-6-19(28)15-21(23)25)10-3-2-9-32-11-13-34-14-12-32/h4-8,15-18H,2-3,9-14H2,1H3 |
| InChIKey | KCZFSSGOIFRSCJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|