About methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate
methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate (PubChem CID 155816686) has the molecular formula C20H23F3N4O2
and a molecular weight of 408.42 g/mol. Its IUPAC name is methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate |
| PubChem CID | 155816686 |
| Molecular Formula | C20H23F3N4O2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(N/C(N)=N/CCC(C)(C)c2ccc(C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C20H23F3N4O2/c1-19(2,14-5-7-15(8-6-14)20(21,22)23)10-11-25-18(24)27-16-9-4-13(12-26-16)17(28)29-3/h4-9,12H,10-11H2,1-3H3,(H3,24,25,26,27) |
| InChIKey | QDSHUUVGBLMTPV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate?
The IUPAC name of methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate (CID 155816686) is methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate.
What is the SMILES notation for methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate?
The canonical SMILES for methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate is COC(=O)c1ccc(N/C(N)=N/CCC(C)(C)c2ccc(C(F)(F)F)cc2)nc1.
What is the InChIKey of methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate?
The InChIKey is QDSHUUVGBLMTPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F3N4O2/c1-19(2,14-5-7-15(8-6-14)20(21,22)23)10-11-25-18(24)27-16-9-4-13(12-26-16)17(28)29-3/h4-9,12H,10-11H2,1-3H3,(H3,24,25,26,27).
What are the key properties of methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate?
methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate has a molecular weight of 408.42 g/mol, XLogP of 3.98, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[[N'-[3-methyl-3-[4-(trifluoromethyl)phenyl]butyl]carbamimidoyl]amino]pyridine-3-carboxylate is sourced from PubChem (CID 155816686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).