C13H9N5OS — CID 155816701
5-(4-methylphenyl)-3-thia-1,8,10,11,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-7-one (PubChem CID 155816701) has the molecular formula C13H9N5OS and a molecular weight of 283.32 g/mol. Its IUPAC name is 5-(4-methylphenyl)-3-thia-1,8,10,11,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-7-one.
| Compound Name | 5-(4-methylphenyl)-3-thia-1,8,10,11,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-7-one |
|---|---|
| PubChem CID | 155816701 |
| Molecular Formula | C13H9N5OS |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 5-(4-methylphenyl)-3-thia-1,8,10,11,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),4,9,11-tetraen-7-one |
| SMILES | Cc1ccc(-c2csc3c2c(=O)[nH]c2nnnn23)cc1 |
| InChI | InChI=1S/C13H9N5OS/c1-7-2-4-8(5-3-7)9-6-20-12-10(9)11(19)14-13-15-16-17-18(12)13/h2-6H,1H3,(H,14,15,17,19) |
| InChIKey | ORWUHKLJXLQXJL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |