About 7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid
7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid (PubChem CID 155816832) has the molecular formula C13H7FN2O3S
and a molecular weight of 290.28 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid.
Molecular Properties
| Compound Name | 7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid |
| PubChem CID | 155816832 |
| Molecular Formula | C13H7FN2O3S |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid |
| SMILES | O=C(O)c1cc(-c2ccc(F)cc2)c2sc(=O)[nH]c2n1 |
| InChI | InChI=1S/C13H7FN2O3S/c14-7-3-1-6(2-4-7)8-5-9(12(17)18)15-11-10(8)20-13(19)16-11/h1-5H,(H,17,18)(H,15,16,19) |
| InChIKey | NIUZWCAMBVSLKS-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid?
The IUPAC name of 7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid (CID 155816832) is 7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid.
What is the SMILES notation for 7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid?
The canonical SMILES for 7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid is O=C(O)c1cc(-c2ccc(F)cc2)c2sc(=O)[nH]c2n1.
What is the InChIKey of 7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid?
The InChIKey is NIUZWCAMBVSLKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7FN2O3S/c14-7-3-1-6(2-4-7)8-5-9(12(17)18)15-11-10(8)20-13(19)16-11/h1-5H,(H,17,18)(H,15,16,19).
What are the key properties of 7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid?
7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid has a molecular weight of 290.28 g/mol, XLogP of 2.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4-fluorophenyl)-2-oxo-3H-[1,3]thiazolo[4,5-b]pyridine-5-carboxylic acid is sourced from PubChem (CID 155816832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).