C27H29N5S — CID 155816905
2-[1-(4-piperidin-1-ylbutyl)indol-3-yl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazole (PubChem CID 155816905) has the molecular formula C27H29N5S and a molecular weight of 455.63 g/mol. Its IUPAC name is 2-[1-(4-piperidin-1-ylbutyl)indol-3-yl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazole.
| Compound Name | 2-[1-(4-piperidin-1-ylbutyl)indol-3-yl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 155816905 |
| Molecular Formula | C27H29N5S |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 2-[1-(4-piperidin-1-ylbutyl)indol-3-yl]-4-(1H-pyrrolo[2,3-b]pyridin-3-yl)-1,3-thiazole |
| SMILES | c1cnc2[nH]cc(-c3csc(-c4cn(CCCCN5CCCCC5)c5ccccc45)n3)c2c1 |
| InChI | InChI=1S/C27H29N5S/c1-4-13-31(14-5-1)15-6-7-16-32-18-23(20-9-2-3-11-25(20)32)27-30-24(19-33-27)22-17-29-26-21(22)10-8-12-28-26/h2-3,8-12,17-19H,1,4-7,13-16H2,(H,28,29) |
| InChIKey | GZFWAWIDFAZMGZ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|