About [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene
[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene (PubChem CID 155817105) has the molecular formula C17H15FN4
and a molecular weight of 294.33 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene.
Molecular Properties
| Compound Name | [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene |
| PubChem CID | 155817105 |
| Molecular Formula | C17H15FN4 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene |
| SMILES | Cc1nn(-c2ccc(F)cc2)c(C)c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C17H15FN4/c1-12-17(20-19-15-6-4-3-5-7-15)13(2)22(21-12)16-10-8-14(18)9-11-16/h3-11H,1-2H3/b20-19+ |
| InChIKey | CHQOIOJMRDNHAQ-FMQUCBEESA-N |
| XLogP | 5.04 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene?
The IUPAC name of [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene (CID 155817105) is [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene.
What is the SMILES notation for [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene?
The canonical SMILES for [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene is Cc1nn(-c2ccc(F)cc2)c(C)c1/N=N/c1ccccc1.
What is the InChIKey of [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene?
The InChIKey is CHQOIOJMRDNHAQ-FMQUCBEESA-N. The full InChI is InChI=1S/C17H15FN4/c1-12-17(20-19-15-6-4-3-5-7-15)13(2)22(21-12)16-10-8-14(18)9-11-16/h3-11H,1-2H3/b20-19+.
What are the key properties of [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene?
[1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene has a molecular weight of 294.33 g/mol, XLogP of 5.04, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-fluorophenyl)-3,5-dimethylpyrazol-4-yl]-phenyldiazene is sourced from PubChem (CID 155817105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).