About (6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one
(6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one (PubChem CID 155817371) has the molecular formula C19H16O5
and a molecular weight of 324.33 g/mol. Its IUPAC name is (6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one.
Molecular Properties
| Compound Name | (6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one |
| PubChem CID | 155817371 |
| Molecular Formula | C19H16O5 |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one |
| SMILES | COc1ccc(OC)c(/C=C2\Cc3cc4c(cc3C2=O)OCO4)c1 |
| InChI | InChI=1S/C19H16O5/c1-21-14-3-4-16(22-2)12(7-14)6-13-5-11-8-17-18(24-10-23-17)9-15(11)19(13)20/h3-4,6-9H,5,10H2,1-2H3/b13-6+ |
| InChIKey | HIOJDSBCBLRTDM-AWNIVKPZSA-N |
| XLogP | 3.25 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one?
The IUPAC name of (6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one (CID 155817371) is (6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one.
What is the SMILES notation for (6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one?
The canonical SMILES for (6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one is COc1ccc(OC)c(/C=C2\Cc3cc4c(cc3C2=O)OCO4)c1.
What is the InChIKey of (6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one?
The InChIKey is HIOJDSBCBLRTDM-AWNIVKPZSA-N. The full InChI is InChI=1S/C19H16O5/c1-21-14-3-4-16(22-2)12(7-14)6-13-5-11-8-17-18(24-10-23-17)9-15(11)19(13)20/h3-4,6-9H,5,10H2,1-2H3/b13-6+.
What are the key properties of (6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one?
(6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one has a molecular weight of 324.33 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-[(2,5-dimethoxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one is sourced from PubChem (CID 155817371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).