About 3-pyrimidin-5-yl-1,3-oxazolidin-2-one
3-pyrimidin-5-yl-1,3-oxazolidin-2-one (PubChem CID 155817822) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is 3-pyrimidin-5-yl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-pyrimidin-5-yl-1,3-oxazolidin-2-one |
| PubChem CID | 155817822 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | 3-pyrimidin-5-yl-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1cncnc1 |
| InChI | InChI=1S/C7H7N3O2/c11-7-10(1-2-12-7)6-3-8-5-9-4-6/h3-5H,1-2H2 |
| InChIKey | GIPXJCOKNCOYKK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-pyrimidin-5-yl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrimidin-5-yl-1,3-oxazolidin-2-one?
The IUPAC name of 3-pyrimidin-5-yl-1,3-oxazolidin-2-one (CID 155817822) is 3-pyrimidin-5-yl-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-pyrimidin-5-yl-1,3-oxazolidin-2-one?
The canonical SMILES for 3-pyrimidin-5-yl-1,3-oxazolidin-2-one is O=C1OCCN1c1cncnc1.
What is the InChIKey of 3-pyrimidin-5-yl-1,3-oxazolidin-2-one?
The InChIKey is GIPXJCOKNCOYKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c11-7-10(1-2-12-7)6-3-8-5-9-4-6/h3-5H,1-2H2.
What are the key properties of 3-pyrimidin-5-yl-1,3-oxazolidin-2-one?
3-pyrimidin-5-yl-1,3-oxazolidin-2-one has a molecular weight of 165.15 g/mol, XLogP of 0.43, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrimidin-5-yl-1,3-oxazolidin-2-one is sourced from PubChem (CID 155817822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).