C11H21BrN2 — CID 155817839
4-methyl-1,1-bis(prop-2-enyl)piperazin-1-ium bromide (PubChem CID 155817839) has the molecular formula C11H21BrN2 and a molecular weight of 261.21 g/mol. Its IUPAC name is 4-methyl-1,1-bis(prop-2-enyl)piperazin-1-ium bromide.
| Compound Name | 4-methyl-1,1-bis(prop-2-enyl)piperazin-1-ium bromide |
|---|---|
| PubChem CID | 155817839 |
| Molecular Formula | C11H21BrN2 |
| Molecular Weight | 261.21 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 4-methyl-1,1-bis(prop-2-enyl)piperazin-1-ium bromide |
| SMILES | C=CC[N+]1(CC=C)CCN(C)CC1.[Br-] |
| InChI | InChI=1S/C11H21N2.BrH/c1-4-8-13(9-5-2)10-6-12(3)7-11-13;/h4-5H,1-2,6-11H2,3H3;1H/q+1;/p-1 |
| InChIKey | LUZMNCNPBYXCQQ-UHFFFAOYSA-M |
| XLogP | -1.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.21 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|