About butane-1-sulfonate;1,4-dimethylpiperazin-1-ium
butane-1-sulfonate;1,4-dimethylpiperazin-1-ium (PubChem CID 155817884) has the molecular formula C10H24N2O3S
and a molecular weight of 252.38 g/mol. Its IUPAC name is butane-1-sulfonate;1,4-dimethylpiperazin-1-ium.
Molecular Properties
| Compound Name | butane-1-sulfonate;1,4-dimethylpiperazin-1-ium |
| PubChem CID | 155817884 |
| Molecular Formula | C10H24N2O3S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | butane-1-sulfonate;1,4-dimethylpiperazin-1-ium |
| SMILES | CCCCS(=O)(=O)[O-].CN1CC[NH+](C)CC1 |
| InChI | InChI=1S/C6H14N2.C4H10O3S/c1-7-3-5-8(2)6-4-7;1-2-3-4-8(5,6)7/h3-6H2,1-2H3;2-4H2,1H3,(H,5,6,7) |
| InChIKey | AOIUDDKFKGGGTP-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 64.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze butane-1-sulfonate;1,4-dimethylpiperazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1-sulfonate;1,4-dimethylpiperazin-1-ium?
The IUPAC name of butane-1-sulfonate;1,4-dimethylpiperazin-1-ium (CID 155817884) is butane-1-sulfonate;1,4-dimethylpiperazin-1-ium.
What is the SMILES notation for butane-1-sulfonate;1,4-dimethylpiperazin-1-ium?
The canonical SMILES for butane-1-sulfonate;1,4-dimethylpiperazin-1-ium is CCCCS(=O)(=O)[O-].CN1CC[NH+](C)CC1.
What is the InChIKey of butane-1-sulfonate;1,4-dimethylpiperazin-1-ium?
The InChIKey is AOIUDDKFKGGGTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.C4H10O3S/c1-7-3-5-8(2)6-4-7;1-2-3-4-8(5,6)7/h3-6H2,1-2H3;2-4H2,1H3,(H,5,6,7).
What are the key properties of butane-1-sulfonate;1,4-dimethylpiperazin-1-ium?
butane-1-sulfonate;1,4-dimethylpiperazin-1-ium has a molecular weight of 252.38 g/mol, XLogP of -1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1-sulfonate;1,4-dimethylpiperazin-1-ium is sourced from PubChem (CID 155817884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).