C27H39Cl2N5O4S — CID 155818357
2-[6-(4-cyclohexylsulfonylpiperazin-1-yl)-4-oxo-1,2,4a,5,6,7,8,8a-octahydroquinazolin-3-yl]-N-[(3,4-dichlorophenyl)methyl]acetamide (PubChem CID 155818357) has the molecular formula C27H39Cl2N5O4S and a molecular weight of 600.61 g/mol. Its IUPAC name is 2-[6-(4-cyclohexylsulfonylpiperazin-1-yl)-4-oxo-1,2,4a,5,6,7,8,8a-octahydroquinazolin-3-yl]-N-[(3,4-dichlorophenyl)methyl]acetamide.
| Compound Name | 2-[6-(4-cyclohexylsulfonylpiperazin-1-yl)-4-oxo-1,2,4a,5,6,7,8,8a-octahydroquinazolin-3-yl]-N-[(3,4-dichlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 155818357 |
| Molecular Formula | C27H39Cl2N5O4S |
| Molecular Weight | 600.61 g/mol |
| Exact Mass | 599.21 |
| IUPAC Name | 2-[6-(4-cyclohexylsulfonylpiperazin-1-yl)-4-oxo-1,2,4a,5,6,7,8,8a-octahydroquinazolin-3-yl]-N-[(3,4-dichlorophenyl)methyl]acetamide |
| SMILES | O=C(CN1CNC2CCC(N3CCN(S(=O)(=O)C4CCCCC4)CC3)CC2C1=O)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H39Cl2N5O4S/c28-23-8-6-19(14-24(23)29)16-30-26(35)17-33-18-31-25-9-7-20(15-22(25)27(33)36)32-10-12-34(13-11-32)39(37,38)21-4-2-1-3-5-21/h6,8,14,20-22,25,31H,1-5,7,9-13,15-18H2,(H,30,35) |
| InChIKey | WORIPTVLKGOBQJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.61 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |