C9H14O3 — CID 155818510
(3aR,4R,5R,6aS)-4-ethenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol (PubChem CID 155818510) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-ethenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol.
| Compound Name | (3aR,4R,5R,6aS)-4-ethenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
|---|---|
| PubChem CID | 155818510 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-ethenyl-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-2,5-diol |
| SMILES | C=C[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C9H14O3/c1-2-5-6-3-9(11)12-8(6)4-7(5)10/h2,5-11H,1,3-4H2/t5-,6-,7-,8+,9?/m1/s1 |
| InChIKey | ACQUALYKLOHFLY-NBTWYFBKSA-N |
| XLogP | 0.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|