About 4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid
4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid (PubChem CID 155818513) has the molecular formula C21H15N3O4
and a molecular weight of 373.37 g/mol. Its IUPAC name is 4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid.
Molecular Properties
| Compound Name | 4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid |
| PubChem CID | 155818513 |
| Molecular Formula | C21H15N3O4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid |
| SMILES | O=C(O)c1ccc(Nc2c(-c3ccccc3)nc3ccccn23)cc1C(=O)O |
| InChI | InChI=1S/C21H15N3O4/c25-20(26)15-10-9-14(12-16(15)21(27)28)22-19-18(13-6-2-1-3-7-13)23-17-8-4-5-11-24(17)19/h1-12,22H,(H,25,26)(H,27,28) |
| InChIKey | RSBAGHOCQVUFFP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid?
The IUPAC name of 4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid (CID 155818513) is 4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid.
What is the SMILES notation for 4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid?
The canonical SMILES for 4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid is O=C(O)c1ccc(Nc2c(-c3ccccc3)nc3ccccn23)cc1C(=O)O.
What is the InChIKey of 4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid?
The InChIKey is RSBAGHOCQVUFFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N3O4/c25-20(26)15-10-9-14(12-16(15)21(27)28)22-19-18(13-6-2-1-3-7-13)23-17-8-4-5-11-24(17)19/h1-12,22H,(H,25,26)(H,27,28).
What are the key properties of 4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid?
4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid has a molecular weight of 373.37 g/mol, XLogP of 4.14, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-phenylimidazo[1,2-a]pyridin-3-yl)amino]phthalic acid is sourced from PubChem (CID 155818513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).