C19H19N5O — CID 155818571
2-benzyl-N-cyclopropyl-6-(1-methyltriazol-4-yl)pyridine-4-carboxamide (PubChem CID 155818571) has the molecular formula C19H19N5O and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-benzyl-N-cyclopropyl-6-(1-methyltriazol-4-yl)pyridine-4-carboxamide.
| Compound Name | 2-benzyl-N-cyclopropyl-6-(1-methyltriazol-4-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 155818571 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 2-benzyl-N-cyclopropyl-6-(1-methyltriazol-4-yl)pyridine-4-carboxamide |
| SMILES | Cn1cc(-c2cc(C(=O)NC3CC3)cc(Cc3ccccc3)n2)nn1 |
| InChI | InChI=1S/C19H19N5O/c1-24-12-18(22-23-24)17-11-14(19(25)21-15-7-8-15)10-16(20-17)9-13-5-3-2-4-6-13/h2-6,10-12,15H,7-9H2,1H3,(H,21,25) |
| InChIKey | NUQGANYMFKALLD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |