About 5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide
5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide (PubChem CID 155819056) has the molecular formula C19H16Br2N2O4
and a molecular weight of 496.16 g/mol. Its IUPAC name is 5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide.
Molecular Properties
| Compound Name | 5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide |
| PubChem CID | 155819056 |
| Molecular Formula | C19H16Br2N2O4 |
| Molecular Weight | 496.16 g/mol |
| Exact Mass | 493.95 |
| IUPAC Name | 5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide |
| SMILES | O=C(O)c1cc(C[n+]2ccc(-c3cc[nH+]cc3)cc2)cc(C(=O)O)c1.[Br-].[Br-] |
| InChI | InChI=1S/C19H14N2O4.2BrH/c22-18(23)16-9-13(10-17(11-16)19(24)25)12-21-7-3-15(4-8-21)14-1-5-20-6-2-14;;/h1-11H,12H2,(H-,22,23,24,25);2*1H |
| InChIKey | YLWRNDYGNISEMQ-UHFFFAOYSA-N |
| XLogP | -4.09 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 496.16 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide?
The IUPAC name of 5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide (CID 155819056) is 5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide.
What is the SMILES notation for 5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide?
The canonical SMILES for 5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide is O=C(O)c1cc(C[n+]2ccc(-c3cc[nH+]cc3)cc2)cc(C(=O)O)c1.[Br-].[Br-].
What is the InChIKey of 5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide?
The InChIKey is YLWRNDYGNISEMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O4.2BrH/c22-18(23)16-9-13(10-17(11-16)19(24)25)12-21-7-3-15(4-8-21)14-1-5-20-6-2-14;;/h1-11H,12H2,(H-,22,23,24,25);2*1H.
What are the key properties of 5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide?
5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide has a molecular weight of 496.16 g/mol, XLogP of -4.09, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-pyridin-1-ium-4-ylpyridin-1-ium-1-yl)methyl]benzene-1,3-dicarboxylic acid dibromide is sourced from PubChem (CID 155819056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).