About 8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid
8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid (PubChem CID 155819629) has the molecular formula C8H11FO4S
and a molecular weight of 222.24 g/mol. Its IUPAC name is 8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid.
Molecular Properties
| Compound Name | 8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid |
| PubChem CID | 155819629 |
| Molecular Formula | C8H11FO4S |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | 8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid |
| SMILES | O=C(O)C1(F)CS(=O)(=O)CC12CCC2 |
| InChI | InChI=1S/C8H11FO4S/c9-8(6(10)11)5-14(12,13)4-7(8)2-1-3-7/h1-5H2,(H,10,11) |
| InChIKey | RPVPDVDDAXTHTC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid?
The IUPAC name of 8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid (CID 155819629) is 8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid.
What is the SMILES notation for 8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid?
The canonical SMILES for 8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid is O=C(O)C1(F)CS(=O)(=O)CC12CCC2.
What is the InChIKey of 8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid?
The InChIKey is RPVPDVDDAXTHTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FO4S/c9-8(6(10)11)5-14(12,13)4-7(8)2-1-3-7/h1-5H2,(H,10,11).
What are the key properties of 8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid?
8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid has a molecular weight of 222.24 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-6,6-dioxo-6λ6-thiaspiro[3.4]octane-8-carboxylic acid is sourced from PubChem (CID 155819629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).