potassium trifluoro(3-trimethylsilylpropyl)boranuide

C6H15BF3KSi — CID 155819799

IUPACpotassium trifluoro(3-trimethylsilylpropyl)boranuide
SMILESC[Si](C)(C)CCC[B-](F)(F)F.[K+]
InChIInChI=1S/C6H15BF3Si.K/c1-11(2,3)6-4-5-7(8,9)10;/h4-6H2,1-3H3;/q-1;+1
InChIKeyRPVFHZYVZXSDEO-UHFFFAOYSA-N
MW222.18 g/mol
LogP0.57
Rot. Bonds4

About potassium trifluoro(3-trimethylsilylpropyl)boranuide

potassium trifluoro(3-trimethylsilylpropyl)boranuide (PubChem CID 155819799) has the molecular formula C6H15BF3KSi and a molecular weight of 222.18 g/mol. Its IUPAC name is potassium trifluoro(3-trimethylsilylpropyl)boranuide.

Molecular Properties

Compound Namepotassium trifluoro(3-trimethylsilylpropyl)boranuide
PubChem CID155819799
Molecular FormulaC6H15BF3KSi
Molecular Weight222.18 g/mol
Exact Mass222.06
IUPAC Namepotassium trifluoro(3-trimethylsilylpropyl)boranuide
SMILESC[Si](C)(C)CCC[B-](F)(F)F.[K+]
InChIInChI=1S/C6H15BF3Si.K/c1-11(2,3)6-4-5-7(8,9)10;/h4-6H2,1-3H3;/q-1;+1
InChIKeyRPVFHZYVZXSDEO-UHFFFAOYSA-N
XLogP0.57
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500222.18
LogP ≤ 50.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze potassium trifluoro(3-trimethylsilylpropyl)boranuide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium trifluoro(3-trimethylsilylpropyl)boranuide?
The IUPAC name of potassium trifluoro(3-trimethylsilylpropyl)boranuide (CID 155819799) is potassium trifluoro(3-trimethylsilylpropyl)boranuide.
What is the SMILES notation for potassium trifluoro(3-trimethylsilylpropyl)boranuide?
The canonical SMILES for potassium trifluoro(3-trimethylsilylpropyl)boranuide is C[Si](C)(C)CCC[B-](F)(F)F.[K+].
What is the InChIKey of potassium trifluoro(3-trimethylsilylpropyl)boranuide?
The InChIKey is RPVFHZYVZXSDEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15BF3Si.K/c1-11(2,3)6-4-5-7(8,9)10;/h4-6H2,1-3H3;/q-1;+1.
What are the key properties of potassium trifluoro(3-trimethylsilylpropyl)boranuide?
potassium trifluoro(3-trimethylsilylpropyl)boranuide has a molecular weight of 222.18 g/mol, XLogP of 0.57, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium trifluoro(3-trimethylsilylpropyl)boranuide is sourced from PubChem (CID 155819799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).