C5H12ClNO3 — CID 155819857
(1R,2R,3R)-3-aminooxycyclopentane-1,2-diol;hydrochloride (PubChem CID 155819857) has the molecular formula C5H12ClNO3 and a molecular weight of 169.61 g/mol. Its IUPAC name is (1R,2R,3R)-3-aminooxycyclopentane-1,2-diol;hydrochloride.
| Compound Name | (1R,2R,3R)-3-aminooxycyclopentane-1,2-diol;hydrochloride |
|---|---|
| PubChem CID | 155819857 |
| Molecular Formula | C5H12ClNO3 |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | (1R,2R,3R)-3-aminooxycyclopentane-1,2-diol;hydrochloride |
| SMILES | Cl.NO[C@@H]1CC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C5H11NO3.ClH/c6-9-4-2-1-3(7)5(4)8;/h3-5,7-8H,1-2,6H2;1H/t3-,4-,5-;/m1./s1 |
| InChIKey | FFMBDHVPIWEHIX-DEVUXVJFSA-N |
| XLogP | -0.82 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|