About 1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride
1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride (PubChem CID 155819959) has the molecular formula C7H14ClNO2S
and a molecular weight of 211.71 g/mol. Its IUPAC name is 1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride.
Molecular Properties
| Compound Name | 1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride |
| PubChem CID | 155819959 |
| Molecular Formula | C7H14ClNO2S |
| Molecular Weight | 211.71 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride |
| SMILES | Cl.O=S1(=O)CCC12CCNCC2 |
| InChI | InChI=1S/C7H13NO2S.ClH/c9-11(10)6-3-7(11)1-4-8-5-2-7;/h8H,1-6H2;1H |
| InChIKey | LEYYFFDMKXEPOW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.71 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride?
The IUPAC name of 1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride (CID 155819959) is 1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride.
What is the SMILES notation for 1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride?
The canonical SMILES for 1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride is Cl.O=S1(=O)CCC12CCNCC2.
What is the InChIKey of 1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride?
The InChIKey is LEYYFFDMKXEPOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2S.ClH/c9-11(10)6-3-7(11)1-4-8-5-2-7;/h8H,1-6H2;1H.
What are the key properties of 1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride?
1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride has a molecular weight of 211.71 g/mol, XLogP of 0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1λ6-thia-7-azaspiro[3.5]nonane 1,1-dioxide;hydrochloride is sourced from PubChem (CID 155819959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).