About 5,5-dimethylazepan-2-one;hydrochloride
5,5-dimethylazepan-2-one;hydrochloride (PubChem CID 155820040) has the molecular formula C8H16ClNO
and a molecular weight of 177.67 g/mol. Its IUPAC name is 5,5-dimethylazepan-2-one;hydrochloride.
Molecular Properties
| Compound Name | 5,5-dimethylazepan-2-one;hydrochloride |
| PubChem CID | 155820040 |
| Molecular Formula | C8H16ClNO |
| Molecular Weight | 177.67 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 5,5-dimethylazepan-2-one;hydrochloride |
| SMILES | CC1(C)CCNC(=O)CC1.Cl |
| InChI | InChI=1S/C8H15NO.ClH/c1-8(2)4-3-7(10)9-6-5-8;/h3-6H2,1-2H3,(H,9,10);1H |
| InChIKey | LPSXFUBSIVVDNA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.67 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,5-dimethylazepan-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethylazepan-2-one;hydrochloride?
The IUPAC name of 5,5-dimethylazepan-2-one;hydrochloride (CID 155820040) is 5,5-dimethylazepan-2-one;hydrochloride.
What is the SMILES notation for 5,5-dimethylazepan-2-one;hydrochloride?
The canonical SMILES for 5,5-dimethylazepan-2-one;hydrochloride is CC1(C)CCNC(=O)CC1.Cl.
What is the InChIKey of 5,5-dimethylazepan-2-one;hydrochloride?
The InChIKey is LPSXFUBSIVVDNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO.ClH/c1-8(2)4-3-7(10)9-6-5-8;/h3-6H2,1-2H3,(H,9,10);1H.
What are the key properties of 5,5-dimethylazepan-2-one;hydrochloride?
5,5-dimethylazepan-2-one;hydrochloride has a molecular weight of 177.67 g/mol, XLogP of 1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethylazepan-2-one;hydrochloride is sourced from PubChem (CID 155820040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).