About potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide
potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide (PubChem CID 155820118) has the molecular formula C6H9BF3KO
and a molecular weight of 204.04 g/mol. Its IUPAC name is potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide.
Molecular Properties
| Compound Name | potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide |
| PubChem CID | 155820118 |
| Molecular Formula | C6H9BF3KO |
| Molecular Weight | 204.04 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide |
| SMILES | F[B-](F)(F)[C@@]12COCC[C@@H]1C2.[K+] |
| InChI | InChI=1S/C6H9BF3O.K/c8-7(9,10)6-3-5(6)1-2-11-4-6;/h5H,1-4H2;/q-1;+1/t5-,6+;/m1./s1 |
| InChIKey | MRLRTEZGWJXAAO-IBTYICNHSA-N |
| XLogP | -0.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.04 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide?
The IUPAC name of potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide (CID 155820118) is potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide.
What is the SMILES notation for potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide?
The canonical SMILES for potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide is F[B-](F)(F)[C@@]12COCC[C@@H]1C2.[K+].
What is the InChIKey of potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide?
The InChIKey is MRLRTEZGWJXAAO-IBTYICNHSA-N. The full InChI is InChI=1S/C6H9BF3O.K/c8-7(9,10)6-3-5(6)1-2-11-4-6;/h5H,1-4H2;/q-1;+1/t5-,6+;/m1./s1.
What are the key properties of potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide?
potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide has a molecular weight of 204.04 g/mol, XLogP of -0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium trifluoro-[(1S,6S)-3-oxabicyclo[4.1.0]heptan-1-yl]boranuide is sourced from PubChem (CID 155820118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).