About 4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride
4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride (PubChem CID 155820248) has the molecular formula C9H14Cl2N2O
and a molecular weight of 237.13 g/mol. Its IUPAC name is 4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride.
Molecular Properties
| Compound Name | 4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride |
| PubChem CID | 155820248 |
| Molecular Formula | C9H14Cl2N2O |
| Molecular Weight | 237.13 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride |
| SMILES | CN1CCNc2cccc(O)c21.Cl.Cl |
| InChI | InChI=1S/C9H12N2O.2ClH/c1-11-6-5-10-7-3-2-4-8(12)9(7)11;;/h2-4,10,12H,5-6H2,1H3;2*1H |
| InChIKey | LEGPURJXFFOTBR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.13 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride?
The IUPAC name of 4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride (CID 155820248) is 4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride.
What is the SMILES notation for 4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride?
The canonical SMILES for 4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride is CN1CCNc2cccc(O)c21.Cl.Cl.
What is the InChIKey of 4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride?
The InChIKey is LEGPURJXFFOTBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O.2ClH/c1-11-6-5-10-7-3-2-4-8(12)9(7)11;;/h2-4,10,12H,5-6H2,1H3;2*1H.
What are the key properties of 4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride?
4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride has a molecular weight of 237.13 g/mol, XLogP of 2.10, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-dihydro-1H-quinoxalin-5-ol;dihydrochloride is sourced from PubChem (CID 155820248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).